Glutamic acid (data page)
| The complete data for Glutamic acid () | ||||||||||||||||
| General information Chemical formula: C5H9NO4  Molar mass: 147.13 g·mol−1 Systematic name: (2S)-2-aminopentanedioic acid Abbreviations: E, Glu Synonyms: 2-amino-glutaric acid Glutacid Glutaminic acid | ||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: OC(=O)CCC(N)C(=O)O InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/f/h7,9H - (L) 
 | ||||||||||||||||
| Physical properties | ||||||||||||||||
| 
 
 | ||||||||||||||||
| Hazard properties | ||||||||||||||||
| 
 | ||||||||||||||||
| Chemical properties | ||||||||||||||||
| 
 | ||||||||||||||||
| Pharmacological properties | ||||||||||||||||
  This box:   
- Except where noted otherwise, data relate to Standard temperature and pressure.
- Reliability of data general note.