Leucine (data page)
| The complete data for Leucine () | ||||||||||||||||
| General information Chemical formula: C6H13NO2 Molar mass: 131.18 g·mol−1 Systematic name: (S)-2-amino-4-methyl-pentanoic acid Abbreviations: L, Leu Synonyms: {(S)-/L-}2-amino-4-methylvaleric acid 4-methyl-norvaline α-aminoisocaproic acid | ||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: CC(C)C[C@@H](C(=O)O)N a InChI=1/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/f/h8H b
| ||||||||||||||||
| Physical properties | ||||||||||||||||
| ||||||||||||||||
| Hazard properties | ||||||||||||||||
| ||||||||||||||||
| Chemical properties | ||||||||||||||||
| ||||||||||||||||
| Pharmacological properties | ||||||||||||||||
This box:
- Except where noted otherwise, data relate to Standard temperature and pressure.
- Reliability of data general note.