Stearolic acid

Stearolic acid
Names
	IUPAC name octadec-9-ynoic acid
	Other names 9-octadecynoic acid
Identifiers
CAS Number	506-24-1 ;
3D model (JSmol)	Interactive image;
ChEBI	CHEBI:28801;
ChEMBL	ChEMBL482804;
ChemSpider	61475;
ECHA InfoCard	100.007.301
EC Number	208-030-8;
KEGG	C08459;
PubChem CID	68167;
UNII	7M9KFA3WKU;
CompTox Dashboard (EPA)	DTXSID90198647;
	InChI InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-8,11-17H2,1H3,(H,19,20) Key: RGTIBVZDHOMOKC-UHFFFAOYSA-N;
	SMILES CCCCCCCCC#CCCCCCCCC(=O)O;
Properties
Chemical formula	C18H32O2
Molar mass	280.452 g·mol−1
Appearance	solid
Melting point	45 °C (113 °F; 318 K)
Solubility in water	practically insoluble
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Stearolic acid is an acetylenic fatty acid characterized by an 18-carbon chain with a triple bond between carbons 9 and 10. It is a rare, naturally occurring unsaturated fatty acid, notable for its unique chemical structure and occurrence in certain plant species. Its structural formula is CH₃(CH₂)₇C≡C(CH₂)₇COOH. Its delta notation is 18:1Δ9a.

Stearolic acid is classified as an octadecynoic acid, specifically with the triple bond at the 9-position, hence its common name, 9-octadecynoic acid. The acid is isomeric to linoleic acid and tartaric acid, the latter differing from stearolic acid only in the position of the triple bond. Stearic acid, which has a similar name, has the same chain length but is saturated.