Thioescaline (TE) is a pair of lesser-known psychedelic drugs with the chemical formula C12H19NO2S. They structural analogs of escaline in which an oxygen atom has been replaced with a sulfur atom. They were first synthesized by Alexander Shulgin and reported in his book PiHKAL. Very little is known about their dangers or toxicity.
3-TE
|
| Names |
| IUPAC name
2-[4-Ethoxy-3-methoxy-5-(methylsulfanyl)phenyl]ethanamine |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
| UNII |
|
Key: LRYPRFGBZRIFIX-UHFFFAOYSA-N InChI=1S/C12H19NO2S/c1-4-15-12-10(14-2)7-9(5-6-13)8-11(12)16-3/h7-8H,4-6,13H2,1-3H3
|
|
| Properties |
|
C12H19NO2S |
| Molar mass |
241.35 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references |
- Dosage: 60–80 mg
- Duration: 8–12 hours
- Effects: increased pleasure from art and music, lowering of pitch, and time distortion
|
4-TE
|
| Names |
| IUPAC name
2-[4-(Ethylsulfanyl)-3,5-dimethoxyphenyl]ethanamine |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
Key: JUZZKKJLOWQNPC-UHFFFAOYSA-N InChI=1S/C12H19NO2S/c1-4-16-12-10(14-2)7-9(5-6-13)8-11(12)15-3/h7-8H,4-6,13H2,1-3H3
|
|
| Properties |
|
C12H19NO2S |
| Molar mass |
241.35 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references |
- Dosage: 20–30 mg
- Duration: 9–12 hours
- Effects: open-eye visuals, easy conversation. +++ on the Shulgin Rating Scale
|