2-Ethylhexanol
| Names | |
|---|---|
| Preferred IUPAC name 2-Ethylhexan-1-ol | |
| Other names isooctyl alcohol, 2-ethylhexanol | |
| Identifiers | |
| 3D model (JSmol) | |
| 1719280 | |
| ChEBI | |
| ChEMBL | |
| ChemSpider | |
| ECHA InfoCard | 100.002.941 | 
| EC Number | 
 | 
| KEGG | |
| MeSH | 2-ethylhexanol | 
| PubChem CID | |
| UNII | |
| CompTox Dashboard (EPA) | |
| 
 | |
| 
 | |
| Properties | |
| CH3CH2CH2CH2CH(CH2CH3)CH2OH | |
| Molar mass | 130.231 g·mol−1 | 
| Appearance | Colourless liquid | 
| Density | 833 mg/mL | 
| Melting point | −76 °C (−105 °F; 197 K) | 
| Boiling point | 180 to 186 °C; 356 to 367 °F; 453 to 459 K | 
| log P | 2.721 | 
| Vapor pressure | 30 Pa (at 20 °C) | 
| Refractive index (nD) | 1.431 | 
| Thermochemistry | |
| Heat capacity (C) | 317.5 J/(K·mol) | 
| Std molar entropy (S⦵298) | 347.0 J/(K·mol) | 
| Std enthalpy of formation (ΔfH⦵298) | −433.67–−432.09 kJ/mol | 
| Std enthalpy of combustion (ΔcH⦵298) | −5.28857–−5.28699 MJ/mol | 
| Hazards | |
| Occupational safety and health (OHS/OSH): | |
| Main hazards | Mildly toxic | 
| GHS labelling: | |
| Danger | |
| H302, H312, H315, H318, H335 | |
| P261, P280, P305+P351+P338 | |
| Flash point | 81 °C (178 °F; 354 K) | 
| 290 °C (554 °F; 563 K) | |
| Explosive limits | 0.88–9.7% | 
| Lethal dose or concentration (LD, LC): | |
| LD50 (median dose) | 
 | 
| NIOSH (US health exposure limits): | |
| PEL (Permissible) | none | 
| REL (Recommended) | TWA 50 ppm (270 mg/m3) (skin) | 
| IDLH (Immediate danger) | N.D. | 
| Related compounds | |
| Related alkanol | Propylheptyl alcohol | 
| Related compounds | |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references | |
2-Ethylhexanol (abbreviated 2-EH) is an organic compound with the chemical formula CH3CH2CH2CH2CH(CH2CH3)CH2OH. It is a branched, eight-carbon chiral alcohol. It is a colorless liquid that is poorly soluble in water but soluble in most organic solvents. It is produced on a large scale (>2,000,000,000 kg/y) for use in numerous applications such as solvents, flavors, and fragrances and especially as a precursor for production of other chemicals such as emollients and plasticizers. It is encountered in plants, fruits, and wines. The odor has been reported as "heavy, earthy, and slightly floral" for the R enantiomer and "a light, sweet floral fragrance" for the S enantiomer.