Carrelame
| Names | |
|---|---|
| IUPAC name
(Z)-N-{[(3,5-Dichlorophenyl)amino][(diphenylmethyl)amino]methylene | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references |
glycine
| OtherNames = | Section1 = !Identifiers
|-
|
|
|-
|
3D model (JSmol)
|
|-
| ChEMBL
|
|- | ChemSpider
|
|-
|
PubChem CID
|
|-
| UNII
|
|-
|
CompTox Dashboard (EPA)
|
|-
|
- InChI=1S/C22H19Cl2N3O2/c23-17-11-18(24)13-19(12-17)26-22(25-14-20(28)29)27-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,21H,14H2,(H,28,29)(H2,25,26,27)Key: QMIBAVZANYVPEF-UHFFFAOYSA-N
- InChI=1/C22H19Cl2N3O2/c23-17-11-18(24)13-19(12-17)26-22(25-14-20(28)29)27-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,21H,14H2,(H,28,29)(H2,25,26,27)Key: QMIBAVZANYVPEF-UHFFFAOYAI
|-
|
- c1ccc(cc1)C(c2ccccc2)N/C(=N/CC(=O)O)/Nc3cc(cc(c3)Cl)Cl
|- | Section2 = !Properties
|-
|
| C22H19Cl2N3O2
|- | Molar mass
| 428.31 g·mol−1
|- | Section3 = }}
Carrelame is an extremely high potency artificial sweetener of the guanidine class, closely related to lugduname. While carrelame is roughly 200,000 times as sweet as sucrose, lugduname is still somewhat sweeter. It appears safe in pigs.